CAS 22365-19-1 is the registry number for 6-Amino-5-(2-chloroacetyl)-1-methyl-1,2,3,4-tetrahydropyrimidine-2,4-dione. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
6-amino-5-(2-chloroacetyl)-1-methylpyrimidine-2,4-dione (CAS 22365-19-1) is a chemical compound with the molecular formula C7H8ClN3O3 and a molecular weight of 217.61 g/mol. IUPAC name: 6-amino-5-(2-chloroacetyl)-1-methylpyrimidine-2,4-dione. InChIKey: OORUZOLZIKLBDB-UHFFFAOYSA-N.
| Molecular formula | C7H8ClN3O3 |
|---|---|
| Molecular weight | 217.61 g/mol |
| IUPAC name | 6-amino-5-(2-chloroacetyl)-1-methylpyrimidine-2,4-dione |
| InChIKey | OORUZOLZIKLBDB-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C(=O)NC1=O)C(=O)CCl)N |
Computed by PubChem (NCBI)