CAS 1445993-17-8 is the registry number for BRD4 Inhibitor-33. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-methyl-4-[2-phenoxy-5-(pyrazol-1-ylmethyl)phenyl]-1H-pyrrolo[2,3-c]pyridin-7-one (CAS 1445993-17-8) is a chemical compound with the molecular formula C24H20N4O2 and a molecular weight of 396.4 g/mol. IUPAC name: 6-methyl-4-[2-phenoxy-5-(pyrazol-1-ylmethyl)phenyl]-1H-pyrrolo[2,3-c]pyridin-7-one. InChIKey: BHKWHTCFBHLJLR-UHFFFAOYSA-N.
| Molecular formula | C24H20N4O2 |
|---|---|
| Molecular weight | 396.4 g/mol |
| IUPAC name | 6-methyl-4-[2-phenoxy-5-(pyrazol-1-ylmethyl)phenyl]-1H-pyrrolo[2,3-c]pyridin-7-one |
| InChIKey | BHKWHTCFBHLJLR-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=C(C1=O)NC=C2)C3=C(C=CC(=C3)CN4C=CC=N4)OC5=CC=CC=C5 |
Computed by PubChem (NCBI)