Products 864388-65-8
CAS 864388-65-8 appears in our catalog under these names: MK–28, MK-28, MK-28, 99.88%, MK-28, 99%, 4-((2-(4,6-Diphenylpyrimidin-2-Yl)-2-Methylhydrazineylidene)Methyl)Benzene-1,2-Diol, 98%. Offered by: GLPBio, TargetMol, MedChemExpress, Ambeed, Chemat. Available pack sizes: 10mg, 100mg, 5mg, 50mg, 1mg, 25mg, 5 mg, 10mM/1mL.
4-[(E)-[(4,6-diphenylpyrimidin-2-yl)-methylhydrazinylidene]methyl]benzene-1,2-diol (CAS 864388-65-8) is a chemical compound with the molecular formula C24H20N4O2 and a molecular weight of 396.4 g/mol. IUPAC name: 4-[(E)-[(4,6-diphenylpyrimidin-2-yl)-methylhydrazinylidene]methyl]benzene-1,2-diol. InChIKey: GKOVHCFOVLXKFL-PCLIKHOPSA-N.
| Molecular formula | C24H20N4O2 |
|---|---|
| Molecular weight | 396.4 g/mol |
| IUPAC name | 4-[(E)-[(4,6-diphenylpyrimidin-2-yl)-methylhydrazinylidene]methyl]benzene-1,2-diol |
| InChIKey | GKOVHCFOVLXKFL-PCLIKHOPSA-N |
| SMILES | CN(C1=NC(=CC(=N1)C2=CC=CC=C2)C3=CC=CC=C3)/N=C/C4=CC(=C(C=C4)O)O |
Computed by PubChem (NCBI)
Synonyms:
orb1688178