CAS 1446016-90-5 is the registry number for 4-Fluoro-3-methylphenyl triflate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(4-fluoro-3-methylphenyl) trifluoromethanesulfonate (CAS 1446016-90-5) is a chemical compound with the molecular formula C8H6F4O3S and a molecular weight of 258.19 g/mol. IUPAC name: (4-fluoro-3-methylphenyl) trifluoromethanesulfonate. InChIKey: RQZKQOZJMUOESI-UHFFFAOYSA-N.
| Molecular formula | C8H6F4O3S |
|---|---|
| Molecular weight | 258.19 g/mol |
| IUPAC name | (4-fluoro-3-methylphenyl) trifluoromethanesulfonate |
| InChIKey | RQZKQOZJMUOESI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OS(=O)(=O)C(F)(F)F)F |
Computed by PubChem (NCBI)