Products 959144-35-5
CAS 959144-35-5 is the registry number for 2-Fluoro-4-methoxy-1-((trifluoromethyl)sulfonyl)benzene, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 50mg, 100mg, 250mg, 1g.
2-fluoro-4-methoxy-1-(trifluoromethylsulfonyl)benzene (CAS 959144-35-5) is a chemical compound with the molecular formula C8H6F4O3S and a molecular weight of 258.19 g/mol. IUPAC name: 2-fluoro-4-methoxy-1-(trifluoromethylsulfonyl)benzene. InChIKey: GNTJIIHQBPIKGQ-UHFFFAOYSA-N.
| Molecular formula | C8H6F4O3S |
|---|---|
| Molecular weight | 258.19 g/mol |
| IUPAC name | 2-fluoro-4-methoxy-1-(trifluoromethylsulfonyl)benzene |
| InChIKey | GNTJIIHQBPIKGQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)S(=O)(=O)C(F)(F)F)F |
Computed by PubChem (NCBI)