CAS 1446194-56-4 appears in our catalog under these names: Bortezomib Impurity S, Bortezomib Impurity 86, Bortezomib Impurity 27, N-((1S)-2-((3-Methylbutyl)amino)-2-oxo-1-(phenylmethyl)ethyl)-2-pyrazinecarboxamide, >95% (HPLC), N-((1S)-2-((3-Methylbutyl)amino)-2-oxo-1-(phenylmethyl)ethyl)-2-pyrazinecarboxamide. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
N-[(2S)-1-(3-methylbutylamino)-1-oxo-3-phenylpropan-2-yl]pyrazine-2-carboxamide (CAS 1446194-56-4) is a chemical compound with the molecular formula C19H24N4O2 and a molecular weight of 340.4 g/mol. IUPAC name: N-[(2S)-1-(3-methylbutylamino)-1-oxo-3-phenylpropan-2-yl]pyrazine-2-carboxamide. InChIKey: UJZOAWFAGJVEGQ-INIZCTEOSA-N.
| Molecular formula | C19H24N4O2 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | N-[(2S)-1-(3-methylbutylamino)-1-oxo-3-phenylpropan-2-yl]pyrazine-2-carboxamide |
| InChIKey | UJZOAWFAGJVEGQ-INIZCTEOSA-N |
| SMILES | CC(C)CCNC(=O)[C@H](CC1=CC=CC=C1)NC(=O)C2=NC=CN=C2 |
Computed by PubChem (NCBI)