Products 79410-33-6
CAS 79410-33-6 is the registry number for N3-L-Leu-OH*BHA. Offered by: Iris Biotech. Available pack sizes: 1g, 5g, 25g, 500mg.
(2S)-2-azido-4-methylpentanoic acid;diphenylmethanamine (CAS 79410-33-6) is a chemical compound with the molecular formula C19H24N4O2 and a molecular weight of 340.4 g/mol. IUPAC name: (2S)-2-azido-4-methylpentanoic acid;diphenylmethanamine. InChIKey: KDQXHDVIWDFRBX-ZSCHJXSPSA-N.
| Molecular formula | C19H24N4O2 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | (2S)-2-azido-4-methylpentanoic acid;diphenylmethanamine |
| InChIKey | KDQXHDVIWDFRBX-ZSCHJXSPSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)N=[N+]=[N-].C1=CC=C(C=C1)C(C2=CC=CC=C2)N |
Computed by PubChem (NCBI)