Products 1446263-38-2
CAS 1446263-38-2 appears in our catalog under these names: Linagliptin Impurity 45, Linagliptin Impurity E, Linagliptin Impurity 27, Des-(R)-piperidin-3-amine 8-(R)-(Piperidin-3-ylamino) Linagliptin, >95% (HPLC), Des-(R)-piperidin-3-amine 8-(R)-(Piperidin-3-ylamino) Linagliptin. Offered by: Chemat Brand, TRC, Biosynth, Chemat, Hubei YoungXin. Available pack sizes: on request, 100mg, 10mg, 50mg, 250mg, 500mg, 2000mg, 1000mg.
7-but-2-ynyl-3-methyl-1-[(4-methylquinazolin-2-yl)methyl]-8-[[(3R)-piperidin-3-yl]amino]purine-2,6-dione (CAS 1446263-38-2) is a chemical compound with the molecular formula C25H28N8O2 and a molecular weight of 472.5 g/mol. IUPAC name: 7-but-2-ynyl-3-methyl-1-[(4-methylquinazolin-2-yl)methyl]-8-[[(3R)-piperidin-3-yl]amino]purine-2,6-dione. InChIKey: DOQKYHYFAIBWOA-QGZVFWFLSA-N.
| Molecular formula | C25H28N8O2 |
|---|---|
| Molecular weight | 472.5 g/mol |
| IUPAC name | 7-but-2-ynyl-3-methyl-1-[(4-methylquinazolin-2-yl)methyl]-8-[[(3R)-piperidin-3-yl]amino]purine-2,6-dione |
| InChIKey | DOQKYHYFAIBWOA-QGZVFWFLSA-N |
| SMILES | CC#CCN1C2=C(N=C1N[C@@H]3CCCNC3)N(C(=O)N(C2=O)CC4=NC5=CC=CC=C5C(=N4)C)C |
Computed by PubChem (NCBI)