CAS 14463-68-4 appears in our catalog under these names: 2-Naphthyl phosphate monosodium salt, 95%, 2–Naphthyl phosphate sodium salt, Sodium naphthalen-2-yl hydrogenphosphate, 98%, 98%, Sodium naphthalen-2-yl hydrogenphosphate, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g, 25g.
Sodium naphthalen-2-yl hydrogen phosphate (CAS 14463-68-4) is a chemical compound with the molecular formula C10H8NaO4P and a molecular weight of 246.13 g/mol. IUPAC name: sodium naphthalen-2-yl hydrogen phosphate. InChIKey: GHMHDIFFBHLXTJ-UHFFFAOYSA-M.
| Molecular formula | C10H8NaO4P |
|---|---|
| Molecular weight | 246.13 g/mol |
| IUPAC name | sodium naphthalen-2-yl hydrogen phosphate |
| InChIKey | GHMHDIFFBHLXTJ-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C=C(C=CC2=C1)OP(=O)(O)[O-].[Na+] |
Computed by PubChem (NCBI)