CAS 2650-44-4 appears in our catalog under these names: Alpha-naphthyl acid phosphate monosodium salt, 95%, α–Naphthyl acid phosphate monosodium salt. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 25g, 1g.
Sodium naphthalen-1-yl hydrogen phosphate (CAS 2650-44-4) is a chemical compound with the molecular formula C10H8NaO4P and a molecular weight of 246.13 g/mol. IUPAC name: sodium naphthalen-1-yl hydrogen phosphate. InChIKey: DELRLFMUZXCKAR-UHFFFAOYSA-M.
| Molecular formula | C10H8NaO4P |
|---|---|
| Molecular weight | 246.13 g/mol |
| IUPAC name | sodium naphthalen-1-yl hydrogen phosphate |
| InChIKey | DELRLFMUZXCKAR-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C(=C1)C=CC=C2OP(=O)(O)[O-].[Na+] |
Computed by PubChem (NCBI)