CAS 1446334-75-3 appears in our catalog under these names: 6–Bromo–8–fluoro–2–methylimidazo(1, 2–a)pyridine, 6-Bromo-8-fluoro-2-methylimidazo(1,2-a)pyridine, 6-Bromo-8-fluoro-2-methylimidazo[1,2-a]pyridine, 98%, 98%, 6-BROMO-8-FLUORO-2-METHYLIMIDAZO[1,2-A]PYRIDINE, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 0,5g, 5g, 10g, 25g.
6-bromo-8-fluoro-2-methylimidazo[1,2-a]pyridine (CAS 1446334-75-3) is a chemical compound with the molecular formula C8H6BrFN2 and a molecular weight of 229.05 g/mol. IUPAC name: 6-bromo-8-fluoro-2-methylimidazo[1,2-a]pyridine. InChIKey: UTGAEDZYNAJWRT-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFN2 |
|---|---|
| Molecular weight | 229.05 g/mol |
| IUPAC name | 6-bromo-8-fluoro-2-methylimidazo[1,2-a]pyridine |
| InChIKey | UTGAEDZYNAJWRT-UHFFFAOYSA-N |
| SMILES | CC1=CN2C=C(C=C(C2=N1)F)Br |
Computed by PubChem (NCBI)