Products 144640-75-5
CAS 144640-75-5 is the registry number for 3',5'-Di-O-acetyl O6-benzyl-2'-deoxyguanosine. Offered by: Biosynth. Available pack sizes: 25mg, 10mg, 50mg, 100mg, 250mg.
[(2R,3S,5R)-3-acetyloxy-5-(2-amino-6-phenylmethoxypurin-9-yl)oxolan-2-yl]methyl acetate (CAS 144640-75-5) is a chemical compound with the molecular formula C21H23N5O6 and a molecular weight of 441.4 g/mol. IUPAC name: [(2R,3S,5R)-3-acetyloxy-5-(2-amino-6-phenylmethoxypurin-9-yl)oxolan-2-yl]methyl acetate. InChIKey: QLUZVLZNJMLEJA-GVDBMIGSSA-N.
| Molecular formula | C21H23N5O6 |
|---|---|
| Molecular weight | 441.4 g/mol |
| IUPAC name | [(2R,3S,5R)-3-acetyloxy-5-(2-amino-6-phenylmethoxypurin-9-yl)oxolan-2-yl]methyl acetate |
| InChIKey | QLUZVLZNJMLEJA-GVDBMIGSSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H](C[C@@H](O1)N2C=NC3=C2N=C(N=C3OCC4=CC=CC=C4)N)OC(=O)C |
Computed by PubChem (NCBI)