Products 1446407-06-2
CAS 1446407-06-2 is the registry number for 2-(6-Bromopyridin-3-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(6-bromo-3-pyridinyl)-1,1,1,3,3,3-hexafluoropropan-2-ol (CAS 1446407-06-2) is a chemical compound with the molecular formula C8H4BrF6NO and a molecular weight of 324.02 g/mol. IUPAC name: 2-(6-bromo-3-pyridinyl)-1,1,1,3,3,3-hexafluoropropan-2-ol. InChIKey: YOQCKYHUJUCSCV-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF6NO |
|---|---|
| Molecular weight | 324.02 g/mol |
| IUPAC name | 2-(6-bromo-3-pyridinyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| InChIKey | YOQCKYHUJUCSCV-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(C(F)(F)F)(C(F)(F)F)O)Br |
Computed by PubChem (NCBI)