Products 216765-97-8
CAS 216765-97-8 is the registry number for 3-Bromo-2-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)pyridine, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-bromo-2-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)pyridine (CAS 216765-97-8) is a chemical compound with the molecular formula C8H4BrF6NO and a molecular weight of 324.02 g/mol. IUPAC name: 3-bromo-2-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)pyridine. InChIKey: JHDCDMLUCWEVOQ-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF6NO |
|---|---|
| Molecular weight | 324.02 g/mol |
| IUPAC name | 3-bromo-2-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)pyridine |
| InChIKey | JHDCDMLUCWEVOQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Br)OCC(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)