CAS 1446410-29-2 is the registry number for Regorafenib Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-N-methyl-6-(methylamino)pyridine-2-carboxamide (CAS 1446410-29-2) is a chemical compound with the molecular formula C8H10ClN3O and a molecular weight of 199.64 g/mol. IUPAC name: 4-chloro-N-methyl-6-(methylamino)pyridine-2-carboxamide. InChIKey: XIHHNDPAGXHDIA-UHFFFAOYSA-N.
| Molecular formula | C8H10ClN3O |
|---|---|
| Molecular weight | 199.64 g/mol |
| IUPAC name | 4-chloro-N-methyl-6-(methylamino)pyridine-2-carboxamide |
| InChIKey | XIHHNDPAGXHDIA-UHFFFAOYSA-N |
| SMILES | CNC1=CC(=CC(=N1)C(=O)NC)Cl |
Computed by PubChem (NCBI)