CAS 14465-62-4 appears in our catalog under these names: 2,2-Dimethyl-1,2-dihydroquinoline hydrochloride, 95%, 2,2-Dimethyl-1,2-dihydroquinoline hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,2-dimethyl-1H-quinoline;hydrochloride (CAS 14465-62-4) is a chemical compound with the molecular formula C11H14ClN and a molecular weight of 195.69 g/mol. IUPAC name: 2,2-dimethyl-1H-quinoline;hydrochloride. InChIKey: BRWCOINGAPCVGK-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN |
|---|---|
| Molecular weight | 195.69 g/mol |
| IUPAC name | 2,2-dimethyl-1H-quinoline;hydrochloride |
| InChIKey | BRWCOINGAPCVGK-UHFFFAOYSA-N |
| SMILES | CC1(C=CC2=CC=CC=C2N1)C.Cl |
Computed by PubChem (NCBI)