CAS 1446511-14-3 appears in our catalog under these names: Fmoc-L-Lys(4-N3-Z)-OH, Fmoc-L-Lys(4-N3-Z)-OH 98%. Offered by: Iris Biotech, Ambeed, MedChemExpress. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10mg, 25mg, 50mg.
(2S)-6-[(4-azidophenyl)methoxycarbonylamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid (CAS 1446511-14-3) is a chemical compound with the molecular formula C29H29N5O6 and a molecular weight of 543.6 g/mol. IUPAC name: (2S)-6-[(4-azidophenyl)methoxycarbonylamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid. InChIKey: RSWJAKDWNDKFAB-SANMLTNESA-N.
| Molecular formula | C29H29N5O6 |
|---|---|
| Molecular weight | 543.6 g/mol |
| IUPAC name | (2S)-6-[(4-azidophenyl)methoxycarbonylamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
| InChIKey | RSWJAKDWNDKFAB-SANMLTNESA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCCCNC(=O)OCC4=CC=C(C=C4)N=[N+]=[N-])C(=O)O |
Computed by PubChem (NCBI)