CAS 1836202-27-7 is the registry number for Fmoc-L-Lys(3-N3-Z)-OH. Offered by: Iris Biotech. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
(2S)-6-[(3-azidophenyl)methoxycarbonylamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid (CAS 1836202-27-7) is a chemical compound with the molecular formula C29H29N5O6 and a molecular weight of 543.6 g/mol. IUPAC name: (2S)-6-[(3-azidophenyl)methoxycarbonylamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid. InChIKey: PLTAMXZVGNFVFS-SANMLTNESA-N.
| Molecular formula | C29H29N5O6 |
|---|---|
| Molecular weight | 543.6 g/mol |
| IUPAC name | (2S)-6-[(3-azidophenyl)methoxycarbonylamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
| InChIKey | PLTAMXZVGNFVFS-SANMLTNESA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCCCNC(=O)OCC4=CC(=CC=C4)N=[N+]=[N-])C(=O)O |
Computed by PubChem (NCBI)