Products 1447-14-9

CAS 1447-14-9 appears in our catalog under these names: 2,2-Dichloro-1-methylcyclopropanecarboxylic acid, 95%, 2,2-Dichloro-1-methylcyclopropanecarboxylic acid 97%, 2,2-DICHLORO-1-METHYLCYCLOPROPANE-, 2,2-Dichloro-1-methylcyclopropanecarboxylic acid, 97%, 97%, 2,2-Dichloro-1-methylcyclopropanecarboxylic acid, 98%. Offered by: Combi-blocks, Ambeed, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 10g, 1g, 100g.

Structural formula: {0} (CAS {1})

2,2-dichloro-1-methylcyclopropane-1-carboxylic acid (CAS 1447-14-9) is a chemical compound with the molecular formula C5H6Cl2O2 and a molecular weight of 169.00 g/mol. IUPAC name: 2,2-dichloro-1-methylcyclopropane-1-carboxylic acid. InChIKey: BIUUWIKPBYWKEQ-UHFFFAOYSA-N.

Identity
Molecular formulaC5H6Cl2O2
Molecular weight169.00 g/mol
IUPAC name2,2-dichloro-1-methylcyclopropane-1-carboxylic acid
InChIKeyBIUUWIKPBYWKEQ-UHFFFAOYSA-N
SMILESCC1(CC1(Cl)Cl)C(=O)O

Computed by PubChem (NCBI)