Products 40630-12-4

CAS 40630-12-4 is the registry number for 1,5-Dichloropentane-2,4-dione, 97% (stabilized withHQ+CaCO3), 97% (stabilized withHQ+CaCO3). Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

1,5-dichloropentane-2,4-dione (CAS 40630-12-4) is a chemical compound with the molecular formula C5H6Cl2O2 and a molecular weight of 169.00 g/mol. IUPAC name: 1,5-dichloropentane-2,4-dione. InChIKey: UUZMIZMSMICNNC-UHFFFAOYSA-N.

Identity
Molecular formulaC5H6Cl2O2
Molecular weight169.00 g/mol
IUPAC name1,5-dichloropentane-2,4-dione
InChIKeyUUZMIZMSMICNNC-UHFFFAOYSA-N
SMILESC(C(=O)CCl)C(=O)CCl

Computed by PubChem (NCBI)