CAS 144705-51-1 appears in our catalog under these names: Agomelatine Impurity 7 HBr, Desacetyl-7-desmethyl Agomelatine Hydrobromide, 8-(2-Aminoethyl)naphthalen-2-ol hydrobromide, 95%, 95%. Offered by: Chemat Brand, TRC, Biosynth, Chemat. Available pack sizes: on request, 1g, 250mg, 500mg, 5mg, 10mg, 25mg.
8-(2-aminoethyl)naphthalen-2-ol;hydrobromide (CAS 144705-51-1) is a chemical compound with the molecular formula C12H14BrNO and a molecular weight of 268.15 g/mol. IUPAC name: 8-(2-aminoethyl)naphthalen-2-ol;hydrobromide. InChIKey: FOKMSWFEISQKHX-UHFFFAOYSA-N.
| Molecular formula | C12H14BrNO |
|---|---|
| Molecular weight | 268.15 g/mol |
| IUPAC name | 8-(2-aminoethyl)naphthalen-2-ol;hydrobromide |
| InChIKey | FOKMSWFEISQKHX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2)O)C(=C1)CCN.Br |
Computed by PubChem (NCBI)