CAS 1447209-75-7 is the registry number for (S)-2-(4-Chloro-3-(difluoromethyl)-2-fluorophenyl)pyrrolidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-[4-chloro-3-(difluoromethyl)-2-fluorophenyl]pyrrolidine (CAS 1447209-75-7) is a chemical compound with the molecular formula C11H11ClF3N and a molecular weight of 249.66 g/mol. IUPAC name: (2S)-2-[4-chloro-3-(difluoromethyl)-2-fluorophenyl]pyrrolidine. InChIKey: ULKONVPAJHTYBG-QMMMGPOBSA-N.
| Molecular formula | C11H11ClF3N |
|---|---|
| Molecular weight | 249.66 g/mol |
| IUPAC name | (2S)-2-[4-chloro-3-(difluoromethyl)-2-fluorophenyl]pyrrolidine |
| InChIKey | ULKONVPAJHTYBG-QMMMGPOBSA-N |
| SMILES | C1C[C@H](NC1)C2=C(C(=C(C=C2)Cl)C(F)F)F |
Computed by PubChem (NCBI)