Products 1447569-78-9
CAS 1447569-78-9 appears in our catalog under these names: Tris(1-chloro-2-propyl) Phosphate-d18, Tris(1-chloro-2-propyl) phosphate-d18, 95.0%. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
Tris(1-chloro-1,1,2,3,3,3-hexadeuteriopropan-2-yl) phosphate (CAS 1447569-78-9) is a chemical compound with the molecular formula C9H18Cl3O4P and a molecular weight of 345.7 g/mol. IUPAC name: tris(1-chloro-1,1,2,3,3,3-hexadeuteriopropan-2-yl) phosphate. InChIKey: KVMPUXDNESXNOH-WMQNGQRQSA-N.
| Molecular formula | C9H18Cl3O4P |
|---|---|
| Molecular weight | 345.7 g/mol |
| IUPAC name | tris(1-chloro-1,1,2,3,3,3-hexadeuteriopropan-2-yl) phosphate |
| InChIKey | KVMPUXDNESXNOH-WMQNGQRQSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])Cl)OP(=O)(OC([2H])(C([2H])([2H])[2H])C([2H])([2H])Cl)OC([2H])(C([2H])([2H])[2H])C([2H])([2H])Cl |
Computed by PubChem (NCBI)