Products 6145-73-9

CAS 6145-73-9 is the registry number for Tris(2-chloropropyl) Phosphate, 90%(mixture),RG, 90%(mixture),RG. Offered by: Chemat. Available pack sizes: 25g, 100g, 500g, 2.5kg.

Structural formula: {0} (CAS {1})

Tris(2-chloropropyl) phosphate (CAS 6145-73-9) is a chemical compound with the molecular formula C9H18Cl3O4P and a molecular weight of 327.6 g/mol. IUPAC name: tris(2-chloropropyl) phosphate. InChIKey: GTRSAMFYSUBAGN-UHFFFAOYSA-N.

Identity
Molecular formulaC9H18Cl3O4P
Molecular weight327.6 g/mol
IUPAC nametris(2-chloropropyl) phosphate
InChIKeyGTRSAMFYSUBAGN-UHFFFAOYSA-N
SMILESCC(COP(=O)(OCC(C)Cl)OCC(C)Cl)Cl

Computed by PubChem (NCBI)