CAS 1447606-16-7 appears in our catalog under these names: 8-Bromo-7-chloroquinoline, 95%, 8-Bromo-7-chloroquinoline, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g.
8-bromo-7-chloroquinoline (CAS 1447606-16-7) is a chemical compound with the molecular formula C9H5BrClN and a molecular weight of 242.50 g/mol. IUPAC name: 8-bromo-7-chloroquinoline. InChIKey: QJMJVWVSQGFCOQ-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClN |
|---|---|
| Molecular weight | 242.50 g/mol |
| IUPAC name | 8-bromo-7-chloroquinoline |
| InChIKey | QJMJVWVSQGFCOQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C(C=C2)Cl)Br)N=C1 |
Computed by PubChem (NCBI)