Products 1447607-90-0
CAS 1447607-90-0 is the registry number for 6,7-Dichloro-2-methyl-1,2,3,4-tetrahydroquinoline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6,7-dichloro-2-methyl-1,2,3,4-tetrahydroquinoline (CAS 1447607-90-0) is a chemical compound with the molecular formula C10H11Cl2N and a molecular weight of 216.10 g/mol. IUPAC name: 6,7-dichloro-2-methyl-1,2,3,4-tetrahydroquinoline. InChIKey: CIQLDQNYJCBJQR-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2N |
|---|---|
| Molecular weight | 216.10 g/mol |
| IUPAC name | 6,7-dichloro-2-methyl-1,2,3,4-tetrahydroquinoline |
| InChIKey | CIQLDQNYJCBJQR-UHFFFAOYSA-N |
| SMILES | CC1CCC2=CC(=C(C=C2N1)Cl)Cl |
Computed by PubChem (NCBI)