Products 1447608-03-8
CAS 1447608-03-8 appears in our catalog under these names: Methyl 4–aminoquinoline–8–carboxylate hydrochloride, Methyl 4-aminoquinoline-8-carboxylate hydrochloride, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 250mg.
Methyl 4-aminoquinoline-8-carboxylate;hydrochloride (CAS 1447608-03-8) is a chemical compound with the molecular formula C11H11ClN2O2 and a molecular weight of 238.67 g/mol. IUPAC name: methyl 4-aminoquinoline-8-carboxylate;hydrochloride. InChIKey: RAEAROBFQPXTSH-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2O2 |
|---|---|
| Molecular weight | 238.67 g/mol |
| IUPAC name | methyl 4-aminoquinoline-8-carboxylate;hydrochloride |
| InChIKey | RAEAROBFQPXTSH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC2=C(C=CN=C21)N.Cl |
Computed by PubChem (NCBI)