CAS 1447713-89-4 appears in our catalog under these names: Boronic acid, B-[3-fluoro-4-(4-morpholinylsulfonyl)phenyl]-, 95%, 95%, (3–Fluoro–4–(Morpholinosulfonyl)phenyl)boronic acid, (3-Fluoro-4-(morpholinosulfonyl)phenyl)boronic acid, 95%, (3-fluoro-4-(morpholinosulfonyl)phenyl)boronic acid, 97%. Offered by: Chemat, GLPBio, Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
(3-fluoro-4-morpholin-4-ylsulfonylphenyl)boronic acid (CAS 1447713-89-4) is a chemical compound with the molecular formula C10H13BFNO5S and a molecular weight of 289.09 g/mol. IUPAC name: (3-fluoro-4-morpholin-4-ylsulfonylphenyl)boronic acid. InChIKey: KMIWFPHRSFCXTC-UHFFFAOYSA-N.
| Molecular formula | C10H13BFNO5S |
|---|---|
| Molecular weight | 289.09 g/mol |
| IUPAC name | (3-fluoro-4-morpholin-4-ylsulfonylphenyl)boronic acid |
| InChIKey | KMIWFPHRSFCXTC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)S(=O)(=O)N2CCOCC2)F)(O)O |
Computed by PubChem (NCBI)