CAS 1704121-53-8 appears in our catalog under these names: 4-Fluoro-3-(morpholine-4-sulfonyl)phenylboronic acid, 95%, (4–Fluoro–3–(morpholinosulfonyl) phenyl)boronic acid, (4-fluoro-3-(morpholinosulfonyl)phenyl)boronic acid 98+%, (4-fluoro-3-(morpholinosulfonyl)phenyl)boronic acid, 98+%, 98+%, (4-Fluoro-3-(morpholinosulfonyl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 500mg, 50mg, 100mg, 250mg.
(4-fluoro-3-morpholin-4-ylsulfonylphenyl)boronic acid (CAS 1704121-53-8) is a chemical compound with the molecular formula C10H13BFNO5S and a molecular weight of 289.09 g/mol. IUPAC name: (4-fluoro-3-morpholin-4-ylsulfonylphenyl)boronic acid. InChIKey: CQLKRRBTZFILPW-UHFFFAOYSA-N.
| Molecular formula | C10H13BFNO5S |
|---|---|
| Molecular weight | 289.09 g/mol |
| IUPAC name | (4-fluoro-3-morpholin-4-ylsulfonylphenyl)boronic acid |
| InChIKey | CQLKRRBTZFILPW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)S(=O)(=O)N2CCOCC2)(O)O |
Computed by PubChem (NCBI)