CAS 144782-23-0 is the registry number for N2-Phenoxyacetyl guanine. Offered by: Biosynth. Available pack sizes: 25mg, 50mg, 100mg, 250mg.
N-(6-oxo-1,7-dihydropurin-2-yl)-2-phenoxyacetamide (CAS 144782-23-0) is a chemical compound with the molecular formula C13H11N5O3 and a molecular weight of 285.26 g/mol. IUPAC name: N-(6-oxo-1,7-dihydropurin-2-yl)-2-phenoxyacetamide. InChIKey: VXZMETBWWUIXNK-UHFFFAOYSA-N.
| Molecular formula | C13H11N5O3 |
|---|---|
| Molecular weight | 285.26 g/mol |
| IUPAC name | N-(6-oxo-1,7-dihydropurin-2-yl)-2-phenoxyacetamide |
| InChIKey | VXZMETBWWUIXNK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OCC(=O)NC2=NC3=C(C(=O)N2)NC=N3 |
Computed by PubChem (NCBI)