Products 162320-41-4
CAS 162320-41-4 is the registry number for API32. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-(1,3-benzodioxol-5-ylmethoxy)-7H-purin-2-amine (CAS 162320-41-4) is a chemical compound with the molecular formula C13H11N5O3 and a molecular weight of 285.26 g/mol. IUPAC name: 6-(1,3-benzodioxol-5-ylmethoxy)-7H-purin-2-amine. InChIKey: RCSIXGPWIQUBAG-UHFFFAOYSA-N.
| Molecular formula | C13H11N5O3 |
|---|---|
| Molecular weight | 285.26 g/mol |
| IUPAC name | 6-(1,3-benzodioxol-5-ylmethoxy)-7H-purin-2-amine |
| InChIKey | RCSIXGPWIQUBAG-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)COC3=NC(=NC4=C3NC=N4)N |
Computed by PubChem (NCBI)