CAS 144782-39-8 is the registry number for 3-(3,5-bis(tert-butyl)-4-hydroxyphenyl)-2-(phenylcarbonyl)prop-2-enenitrile. Offered by: Biosynth. Available pack sizes: 250mg.
(E)-2-benzoyl-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enenitrile (CAS 144782-39-8) is a chemical compound with the molecular formula C24H27NO2 and a molecular weight of 361.5 g/mol. IUPAC name: (E)-2-benzoyl-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enenitrile. InChIKey: JCSRLWWDNRVIFI-LDADJPATSA-N.
| Molecular formula | C24H27NO2 |
|---|---|
| Molecular weight | 361.5 g/mol |
| IUPAC name | (E)-2-benzoyl-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enenitrile |
| InChIKey | JCSRLWWDNRVIFI-LDADJPATSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)/C=C(\C#N)/C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)