Products 2714435-95-5
CAS 2714435-95-5 appears in our catalog under these names: Octocrylene–d10, Octocrylene-d10. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 1 mg.
2-ethylhexyl 2-cyano-3,3-bis(2,3,4,5,6-pentadeuteriophenyl)prop-2-enoate (CAS 2714435-95-5) is a chemical compound with the molecular formula C24H27NO2 and a molecular weight of 371.5 g/mol. IUPAC name: 2-ethylhexyl 2-cyano-3,3-bis(2,3,4,5,6-pentadeuteriophenyl)prop-2-enoate. InChIKey: FMJSMJQBSVNSBF-UNUHCXEZSA-N.
| Molecular formula | C24H27NO2 |
|---|---|
| Molecular weight | 371.5 g/mol |
| IUPAC name | 2-ethylhexyl 2-cyano-3,3-bis(2,3,4,5,6-pentadeuteriophenyl)prop-2-enoate |
| InChIKey | FMJSMJQBSVNSBF-UNUHCXEZSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(=C(C#N)C(=O)OCC(CC)CCCC)C2=C(C(=C(C(=C2[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)