CAS 1447941-20-9 is the registry number for (S)-2-((tert-Butoxycarbonyl)amino)-4-fluoro-3,3-dimethylbutanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-4-fluoro-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 1447941-20-9) is a chemical compound with the molecular formula C11H20FNO4 and a molecular weight of 249.28 g/mol. IUPAC name: (2S)-4-fluoro-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: QAWXYJNHGJIZCC-SSDOTTSWSA-N.
| Molecular formula | C11H20FNO4 |
|---|---|
| Molecular weight | 249.28 g/mol |
| IUPAC name | (2S)-4-fluoro-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | QAWXYJNHGJIZCC-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)O)C(C)(C)CF |
Computed by PubChem (NCBI)