CAS 1454914-50-1 is the registry number for 2–(tert–Butoxycarbonylamino)–4–fluoro–4–methylpentanoic acid. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
4-fluoro-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 1454914-50-1) is a chemical compound with the molecular formula C11H20FNO4 and a molecular weight of 249.28 g/mol. IUPAC name: 4-fluoro-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: RNHJCMLXWLYJPF-UHFFFAOYSA-N.
| Molecular formula | C11H20FNO4 |
|---|---|
| Molecular weight | 249.28 g/mol |
| IUPAC name | 4-fluoro-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | RNHJCMLXWLYJPF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(C)(C)F)C(=O)O |
Computed by PubChem (NCBI)