CAS 144810-01-5 is the registry number for (1,4-Dioxa-spiro[4.5]dec-7-en-8-yloxy)-trimethyl-silane, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1,4-dioxaspiro[4.5]dec-7-en-8-yloxy(trimethyl)silane (CAS 144810-01-5) is a chemical compound with the molecular formula C11H20O3Si and a molecular weight of 228.36 g/mol. IUPAC name: 1,4-dioxaspiro[4.5]dec-7-en-8-yloxy(trimethyl)silane. InChIKey: LMKFXRFHCLJKEH-UHFFFAOYSA-N.
| Molecular formula | C11H20O3Si |
|---|---|
| Molecular weight | 228.36 g/mol |
| IUPAC name | 1,4-dioxaspiro[4.5]dec-7-en-8-yloxy(trimethyl)silane |
| InChIKey | LMKFXRFHCLJKEH-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OC1=CCC2(CC1)OCCO2 |
Computed by PubChem (NCBI)