CAS 2260788-42-7 is the registry number for 2-(Trimethylsilyl)ethyl 1-methyl-3-oxocyclobutane-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-trimethylsilylethyl 1-methyl-3-oxocyclobutane-1-carboxylate (CAS 2260788-42-7) is a chemical compound with the molecular formula C11H20O3Si and a molecular weight of 228.36 g/mol. IUPAC name: 2-trimethylsilylethyl 1-methyl-3-oxocyclobutane-1-carboxylate. InChIKey: SELLUKKIJKBJCE-UHFFFAOYSA-N.
| Molecular formula | C11H20O3Si |
|---|---|
| Molecular weight | 228.36 g/mol |
| IUPAC name | 2-trimethylsilylethyl 1-methyl-3-oxocyclobutane-1-carboxylate |
| InChIKey | SELLUKKIJKBJCE-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C1)C(=O)OCC[Si](C)(C)C |
Computed by PubChem (NCBI)