CAS 1448185-87-2 appears in our catalog under these names: N-([1,1'-Biphenyl]-4-yl)dibenzo[b,d]thiophen-4-amine, 95%, N–((1,1'–Biphenyl)–4–yl)dibenzo(b,d)thiophen–4–amine, N-([1,1'-Biphenyl]-4-yl)dibenzo[b,d]thiophen-4-amine, >98.0%(HPLC)(N), N-([1,1'-Biphenyl]-4-yl)dibenzo[b,d]thiophen-4-amine, 98%, 98%, N-([1,1'-Biphenyl]-4-yl)dibenzo[b,d]thiophen-4-amine, 98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 200mg, 100mg, 10g, 25g.
N-(4-phenylphenyl)dibenzothiophen-4-amine (CAS 1448185-87-2) is a chemical compound with the molecular formula C24H17NS and a molecular weight of 351.5 g/mol. IUPAC name: N-(4-phenylphenyl)dibenzothiophen-4-amine. InChIKey: SHLTUEMNYNAKHE-UHFFFAOYSA-N.
| Molecular formula | C24H17NS |
|---|---|
| Molecular weight | 351.5 g/mol |
| IUPAC name | N-(4-phenylphenyl)dibenzothiophen-4-amine |
| InChIKey | SHLTUEMNYNAKHE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)NC3=CC=CC4=C3SC5=CC=CC=C45 |
Computed by PubChem (NCBI)