CAS 2170534-12-8 appears in our catalog under these names: N-([1,1'-Biphenyl]-2-yl)dibenzo[b,d]thiophen-2-amine, 95%, 95%, N-([1,1'-Biphenyl]-2-yl)dibenzo[b,d]thiophen-2-amine, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g.
N-(2-phenylphenyl)dibenzothiophen-2-amine (CAS 2170534-12-8) is a chemical compound with the molecular formula C24H17NS and a molecular weight of 351.5 g/mol. IUPAC name: N-(2-phenylphenyl)dibenzothiophen-2-amine. InChIKey: QYGCNAPUMMSDAL-UHFFFAOYSA-N.
| Molecular formula | C24H17NS |
|---|---|
| Molecular weight | 351.5 g/mol |
| IUPAC name | N-(2-phenylphenyl)dibenzothiophen-2-amine |
| InChIKey | QYGCNAPUMMSDAL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2NC3=CC4=C(C=C3)SC5=CC=CC=C54 |
Computed by PubChem (NCBI)