CAS 1448260-56-7 is the registry number for 7-Bromo-4-chloro-3-quinolinecarboxylic Acid. Offered by: TRC. Available pack sizes: 500mg.
7-bromo-4-chloroquinoline-3-carboxylic acid (CAS 1448260-56-7) is a chemical compound with the molecular formula C10H5BrClNO2 and a molecular weight of 286.51 g/mol. IUPAC name: 7-bromo-4-chloroquinoline-3-carboxylic acid. InChIKey: GBTHKXPOMFCGFD-UHFFFAOYSA-N.
| Molecular formula | C10H5BrClNO2 |
|---|---|
| Molecular weight | 286.51 g/mol |
| IUPAC name | 7-bromo-4-chloroquinoline-3-carboxylic acid |
| InChIKey | GBTHKXPOMFCGFD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=CN=C2C=C1Br)C(=O)O)Cl |
Computed by PubChem (NCBI)