CAS 303212-61-5 is the registry number for 1-(4-Bromo-3-chlorophenyl)pyrrole-2,5-dione, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
1-(4-bromo-3-chlorophenyl)pyrrole-2,5-dione (CAS 303212-61-5) is a chemical compound with the molecular formula C10H5BrClNO2 and a molecular weight of 286.51 g/mol. IUPAC name: 1-(4-bromo-3-chlorophenyl)pyrrole-2,5-dione. InChIKey: ZMEOYUMKMSZANW-UHFFFAOYSA-N.
| Molecular formula | C10H5BrClNO2 |
|---|---|
| Molecular weight | 286.51 g/mol |
| IUPAC name | 1-(4-bromo-3-chlorophenyl)pyrrole-2,5-dione |
| InChIKey | ZMEOYUMKMSZANW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N2C(=O)C=CC2=O)Cl)Br |
Computed by PubChem (NCBI)