CAS 1448309-94-1 is the registry number for Rel-methyl (3R,4R)-3-fluoro-4-hydroxycyclopentane-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-methyl (3R,4R)-3-fluoro-4-hydroxycyclopentane-1-carboxylate (CAS 1448309-94-1) is a chemical compound with the molecular formula C7H11FO3 and a molecular weight of 162.16 g/mol. IUPAC name: trans-methyl (3R,4R)-3-fluoro-4-hydroxycyclopentane-1-carboxylate. InChIKey: RCABWLOYEULSPO-YSLANXFLSA-N.
| Molecular formula | C7H11FO3 |
|---|---|
| Molecular weight | 162.16 g/mol |
| IUPAC name | trans-methyl (3R,4R)-3-fluoro-4-hydroxycyclopentane-1-carboxylate |
| InChIKey | RCABWLOYEULSPO-YSLANXFLSA-N |
| SMILES | COC(=O)C1C[C@H]([C@@H](C1)F)O |
Computed by PubChem (NCBI)