CAS 2840636-44-2 is the registry number for (1S,3R,4R)-3-Fluoro-4-hydroxycyclohexane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,3R,4R)-3-fluoro-4-hydroxycyclohexane-1-carboxylic acid (CAS 2840636-44-2) is a chemical compound with the molecular formula C7H11FO3 and a molecular weight of 162.16 g/mol. IUPAC name: (1S,3R,4R)-3-fluoro-4-hydroxycyclohexane-1-carboxylic acid. InChIKey: RXCJRJYNJDTAAW-KVQBGUIXSA-N.
| Molecular formula | C7H11FO3 |
|---|---|
| Molecular weight | 162.16 g/mol |
| IUPAC name | (1S,3R,4R)-3-fluoro-4-hydroxycyclohexane-1-carboxylic acid |
| InChIKey | RXCJRJYNJDTAAW-KVQBGUIXSA-N |
| SMILES | C1C[C@H]([C@@H](C[C@H]1C(=O)O)F)O |
Computed by PubChem (NCBI)