CAS 1448346-27-7 appears in our catalog under these names: Luxabendazole-d3, D3-Luxabendazole. Offered by: Chemat Brand, HPC Standards, MedChemExpress. Available pack sizes: on request, 1x10mg, 1mg, 5mg.
[2-(trideuteriomethoxycarbonylamino)-3H-benzimidazol-5-yl] 4-fluorobenzenesulfonate (CAS 1448346-27-7) is a chemical compound with the molecular formula C15H12FN3O5S and a molecular weight of 368.4 g/mol. IUPAC name: [2-(trideuteriomethoxycarbonylamino)-3H-benzimidazol-5-yl] 4-fluorobenzenesulfonate. InChIKey: ZVIDWFUBDDXAJA-FIBGUPNXSA-N.
| Molecular formula | C15H12FN3O5S |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | [2-(trideuteriomethoxycarbonylamino)-3H-benzimidazol-5-yl] 4-fluorobenzenesulfonate |
| InChIKey | ZVIDWFUBDDXAJA-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC(=O)NC1=NC2=C(N1)C=C(C=C2)OS(=O)(=O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)