CAS 90509-02-7 appears in our catalog under these names: Luxabendazole, Luxabendazole, >95% (HPLC), Luxabendazole, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Chemat Brand, TRC, MedChemExpress, HPC Standards. Available pack sizes: on request, 1mg, 2,5mg, 2.5 mg, 1 mg, 1x10mg, 1x1ml.
[2-(methoxycarbonylamino)-3H-benzimidazol-5-yl] 4-fluorobenzenesulfonate (CAS 90509-02-7) is a chemical compound with the molecular formula C15H12FN3O5S and a molecular weight of 365.3 g/mol. IUPAC name: [2-(methoxycarbonylamino)-3H-benzimidazol-5-yl] 4-fluorobenzenesulfonate. InChIKey: ZVIDWFUBDDXAJA-UHFFFAOYSA-N.
| Molecular formula | C15H12FN3O5S |
|---|---|
| Molecular weight | 365.3 g/mol |
| IUPAC name | [2-(methoxycarbonylamino)-3H-benzimidazol-5-yl] 4-fluorobenzenesulfonate |
| InChIKey | ZVIDWFUBDDXAJA-UHFFFAOYSA-N |
| SMILES | COC(=O)NC1=NC2=C(N1)C=C(C=C2)OS(=O)(=O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)