CAS 1448346-38-0 appears in our catalog under these names: Albendazole sulphoxide D3, Albendazole Sulfoxide-D3, Albendazole-sulfoxide D3 (methyl D3), Albendazole sulfoxide D3, Albendazole sulfoxide-(methyl-d3). Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, TargetMol, Biosynth. Available pack sizes: on request, 250mg, 10mg, 1mg, 5mg, 2mg, 25mg, 5 mg.
Trideuteriomethyl N-(6-propylsulfinyl-1H-benzimidazol-2-yl)carbamate (CAS 1448346-38-0) is a chemical compound with the molecular formula C12H15N3O3S and a molecular weight of 284.35 g/mol. IUPAC name: trideuteriomethyl N-(6-propylsulfinyl-1H-benzimidazol-2-yl)carbamate. InChIKey: VXTGHWHFYNYFFV-BMSJAHLVSA-N.
| Molecular formula | C12H15N3O3S |
|---|---|
| Molecular weight | 284.35 g/mol |
| IUPAC name | trideuteriomethyl N-(6-propylsulfinyl-1H-benzimidazol-2-yl)carbamate |
| InChIKey | VXTGHWHFYNYFFV-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])OC(=O)NC1=NC2=C(N1)C=C(C=C2)S(=O)CCC |
Computed by PubChem (NCBI)