Products 2886761-69-7
CAS 2886761-69-7 is the registry number for 8-Isopropyl-5-methoxy-2-(methylsulfonyl)pyrido[4,3-d]pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-methoxy-2-methylsulfonyl-8-propan-2-ylpyrido[4,3-d]pyrimidine (CAS 2886761-69-7) is a chemical compound with the molecular formula C12H15N3O3S and a molecular weight of 281.33 g/mol. IUPAC name: 5-methoxy-2-methylsulfonyl-8-propan-2-ylpyrido[4,3-d]pyrimidine. InChIKey: WXLUFZNCYQKCHE-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O3S |
|---|---|
| Molecular weight | 281.33 g/mol |
| IUPAC name | 5-methoxy-2-methylsulfonyl-8-propan-2-ylpyrido[4,3-d]pyrimidine |
| InChIKey | WXLUFZNCYQKCHE-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CN=C(C2=CN=C(N=C21)S(=O)(=O)C)OC |
Computed by PubChem (NCBI)