CAS 1448438-54-7 is the registry number for rac-benzyl N-[(1R,2R)-2-hydroxycycloheptyl]carbamate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Benzyl N-[(1R,2R)-2-hydroxycycloheptyl]carbamate (CAS 1448438-54-7) is a chemical compound with the molecular formula C15H21NO3 and a molecular weight of 263.33 g/mol. IUPAC name: benzyl N-[(1R,2R)-2-hydroxycycloheptyl]carbamate. InChIKey: AMGAYIMPQQNONB-ZIAGYGMSSA-N.
| Molecular formula | C15H21NO3 |
|---|---|
| Molecular weight | 263.33 g/mol |
| IUPAC name | benzyl N-[(1R,2R)-2-hydroxycycloheptyl]carbamate |
| InChIKey | AMGAYIMPQQNONB-ZIAGYGMSSA-N |
| SMILES | C1CC[C@H]([C@@H](CC1)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)