Products 1448452-21-8
CAS 1448452-21-8 is the registry number for TP receptor antagonist-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[2-(4-chlorophenoxy)-5-cyanophenyl]sulfonyl-3-propan-2-ylurea (CAS 1448452-21-8) is a chemical compound with the molecular formula C17H16ClN3O4S and a molecular weight of 393.8 g/mol. IUPAC name: 1-[2-(4-chlorophenoxy)-5-cyanophenyl]sulfonyl-3-propan-2-ylurea. InChIKey: ACKOXVMZLWNATE-UHFFFAOYSA-N.
| Molecular formula | C17H16ClN3O4S |
|---|---|
| Molecular weight | 393.8 g/mol |
| IUPAC name | 1-[2-(4-chlorophenoxy)-5-cyanophenyl]sulfonyl-3-propan-2-ylurea |
| InChIKey | ACKOXVMZLWNATE-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=O)NS(=O)(=O)C1=C(C=CC(=C1)C#N)OC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)
Synonyms:
TP receptor antagonist-1, orb2565135