CAS 5531-21-5 is the registry number for Methyl 2,3-O-isopropylidene-α-L-lyxofuranoside. Offered by: Chemat. Available pack sizes: 100mg, 1g, 250mg, 500mg.
3-chloro-4-ethoxy-N-[(2-methyl-4-nitrophenyl)carbamothioyl]benzamide (CAS 5531-21-5) is a chemical compound with the molecular formula C17H16ClN3O4S and a molecular weight of 393.8 g/mol. IUPAC name: 3-chloro-4-ethoxy-N-[(2-methyl-4-nitrophenyl)carbamothioyl]benzamide. InChIKey: NJDHMZBBUQMWHT-UHFFFAOYSA-N.
| Molecular formula | C17H16ClN3O4S |
|---|---|
| Molecular weight | 393.8 g/mol |
| IUPAC name | 3-chloro-4-ethoxy-N-[(2-methyl-4-nitrophenyl)carbamothioyl]benzamide |
| InChIKey | NJDHMZBBUQMWHT-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)C(=O)NC(=S)NC2=C(C=C(C=C2)[N+](=O)[O-])C)Cl |
Computed by PubChem (NCBI)